Type: Neutral
Formula: C20H40NO3P
SMILES: |
P(OC1CC(CCC1C(C)C)C)(OC1CC(CCC1C(C)C)C)(=O)N |
InChI: |
InChI=1/C20H40NO3P/c1-13(2)17-9-7-15(5)11-19(17)23-25(21,22)24-20-12-16(6)8-10-18(20)14(3)4/h13-20H,7-12H2,1-6H3,(H2,21,22)/t15-,16+,17+,18-,19-,20-,25+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 373.518 g/mol | logS: -6.13444 | SlogP: 4.9378 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.106195 | Sterimol/B1: 2.13212 | Sterimol/B2: 3.06174 | Sterimol/B3: 4.71831 |
Sterimol/B4: 9.08599 | Sterimol/L: 14.7676 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 646.115 | Positive charged surface: 484.281 | Negative charged surface: 161.834 | Volume: 391.5 |
Hydrophobic surface: 483.585 | Hydrophilic surface: 162.53 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |