 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1c2c(ccc(OC(C(=O)NC(CCC(O)=O)C(O)=O)C)c2)C(=CC1=O)c1ccccc1 |
| InChI: | InChI=1/C23H21NO8/c1-13(22(28)24-18(23(29)30)9-10-20(25)26)31-15-7-8-16-17(14-5-3-2-4-6-14)12-21(27)32-19(16)11-15/h2-8,11-13,18H,9-10H2,1H3,(H,24,28)(H,25,26)(H,29,30)/t13-,18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=111.108 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 439.42 g/mol | logS: -5.17402 | SlogP: 2.05609 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0763767 | Sterimol/B1: 2.4619 | Sterimol/B2: 4.05663 | Sterimol/B3: 6.16285 | |||
| Sterimol/B4: 7.28308 | Sterimol/L: 17.4481 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 712.632 | Positive charged surface: 400.377 | Negative charged surface: 312.255 | Volume: 392.125 | |||
| Hydrophobic surface: 406.825 | Hydrophilic surface: 305.807 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
