Type: Neutral
Formula: C16H19N5O
SMILES: |
O=C(NNc1nc(nc(C)c1CC=C)Cc1ccccc1)N |
InChI: |
InChI=1/C16H19N5O/c1-3-7-13-11(2)18-14(10-12-8-5-4-6-9-12)19-15(13)20-21-16(17)22/h3-6,8-9H,1,7,10H2,2H3,(H3,17,21,22)(H,18,19,20) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 297.362 g/mol | logS: -3.55189 | SlogP: 2.09946 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.160455 | Sterimol/B1: 1.969 | Sterimol/B2: 3.26793 | Sterimol/B3: 5.24447 |
Sterimol/B4: 9.88441 | Sterimol/L: 12.9801 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 556.073 | Positive charged surface: 343.72 | Negative charged surface: 212.353 | Volume: 294.125 |
Hydrophobic surface: 363.418 | Hydrophilic surface: 192.655 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |