Type: Neutral
Formula: C18H24O2
SMILES: |
OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 |
InChI: |
InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15+,16+,17-,18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.388 g/mol | logS: -4.21839 | SlogP: 3.60917 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.126807 | Sterimol/B1: 2.93095 | Sterimol/B2: 3.20434 | Sterimol/B3: 4.22746 |
Sterimol/B4: 5.26254 | Sterimol/L: 13.5722 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 471.954 | Positive charged surface: 336.527 | Negative charged surface: 135.428 | Volume: 271.75 |
Hydrophobic surface: 363.375 | Hydrophilic surface: 108.579 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |