Type: Neutral
Formula: C17H22N4
SMILES: |
n1c(cc(nc1NCc1ccccc1)N1CCCCC1)C |
InChI: |
InChI=1/C17H22N4/c1-14-12-16(21-10-6-3-7-11-21)20-17(19-14)18-13-15-8-4-2-5-9-15/h2,4-5,8-9,12H,3,6-7,10-11,13H2,1H3,(H,18,19,20) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 282.391 g/mol | logS: -3.76005 | SlogP: 3.65382 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0611171 | Sterimol/B1: 1.969 | Sterimol/B2: 3.44591 | Sterimol/B3: 3.84317 |
Sterimol/B4: 9.17647 | Sterimol/L: 16.0468 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 567.898 | Positive charged surface: 414.327 | Negative charged surface: 153.571 | Volume: 296.375 |
Hydrophobic surface: 510.633 | Hydrophilic surface: 57.265 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |