 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C([NH3+])CC2N)C([NH3+])CC= C1C[NH3+] |
| InChI: | InChI=1/C19H37N5O7/c1-19(27)7-28-18(13(26)16(19)24-2)31-15-11(23)5-10(22)14(12(15)25)30-17-9(21)4-3-8(6-20)29-17/h3,9-18,24-27H,4-7,20-23H2,1-2H3/p+3/t9-,10+,11-,12+,13-,14+,15-,16+,17-,18-,19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=104.87 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 450.557 g/mol | logS: 0.91884 | SlogP: -6.0019 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.186432 | Sterimol/B1: 3.99007 | Sterimol/B2: 4.78005 | Sterimol/B3: 5.12955 | |||
| Sterimol/B4: 7.26408 | Sterimol/L: 15.7095 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 672.249 | Positive charged surface: 595.564 | Negative charged surface: 76.6852 | Volume: 424.875 | |||
| Hydrophobic surface: 384.682 | Hydrophilic surface: 287.567 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 3 | |||
| Chiral centers: 11 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
