 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C([NH3+])CC2N)C([NH3+])CCC 1C([NH3+])C |
| InChI: | InChI=1/C20H41N5O7/c1-8(21)12-5-4-9(22)18(30-12)31-15-10(23)6-11(24)16(13(15)26)32-19-14(27)17(25-3)20(2,28)7-29-19/h8-19,25-28H,4-7,21-24H2,1-3H3/p+3/t8-,9+,10-,11+,12-,13-,14-,15-,16+,17+,18+,19-,20+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=140.581 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 466.6 g/mol | logS: 0.5196 | SlogP: -5.7386 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.247143 | Sterimol/B1: 2.72293 | Sterimol/B2: 4.26468 | Sterimol/B3: 6.38252 | |||
| Sterimol/B4: 7.55524 | Sterimol/L: 15.4733 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 656.043 | Positive charged surface: 576.428 | Negative charged surface: 79.6151 | Volume: 445 | |||
| Hydrophobic surface: 365.864 | Hydrophilic surface: 290.179 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 3 | |||
| Chiral centers: 13 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
