 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C([NH3+])CC2N)C([NH3+])CCC 1C([NH2+]C)C |
| InChI: | InChI=1/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3/p+3/t9-,10+,11-,12+,13-,14-,15-,16-,17+,18+,19+,20-,21+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=144.666 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 480.627 g/mol | logS: 0.44402 | SlogP: -5.7873 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.226051 | Sterimol/B1: 2.76101 | Sterimol/B2: 5.28003 | Sterimol/B3: 6.52578 | |||
| Sterimol/B4: 6.87648 | Sterimol/L: 16.5295 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 687.287 | Positive charged surface: 607.785 | Negative charged surface: 79.5019 | Volume: 464.625 | |||
| Hydrophobic surface: 407.08 | Hydrophilic surface: 280.207 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 3 | |||
| Chiral centers: 13 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
