 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(OC3OC(CC(=O)C13O)C)C([O-])C([NH2+]C)C(O)C2NC |
| InChI: | InChI=1/C14H23N2O7/c1-5-4-6(17)14(20)13(21-5)22-12-10(19)7(15-2)9(18)8(16-3)11(12)23-14/h5,7-13,15-16,18,20H,4H2,1-3H3/q-1/p+1/t5-,7-,8+,9+,10-,11+,12-,13+,14-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=82.9549 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 332.353 g/mol | logS: 0.08446 | SlogP: -3.5136 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.107048 | Sterimol/B1: 3.56085 | Sterimol/B2: 4.22539 | Sterimol/B3: 4.38123 | |||
| Sterimol/B4: 6.94509 | Sterimol/L: 14.0411 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 529.7 | Positive charged surface: 403.637 | Negative charged surface: 126.063 | Volume: 293.125 | |||
| Hydrophobic surface: 321.061 | Hydrophilic surface: 208.639 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 1 | Basic groups: 1 | |||
| Chiral centers: 9 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
