 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(C(=O)[O-])C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 |
| InChI: | InChI=1/C21H22N2O5S/c1-4-28-13-10-9-11-7-5-6-8-12(11)14(13)17(24)22-15-18(25)23-16(20(26)27)21(2,3)29-19(15)23/h5-10,15-16,19H,4H2,1-3H3,(H,22,24)(H,26,27)/p-1/t15-,16-,19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=115.019 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 413.474 g/mol | logS: -5.93406 | SlogP: 1.1491 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.161116 | Sterimol/B1: 2.48613 | Sterimol/B2: 3.58342 | Sterimol/B3: 5.53644 | |||
| Sterimol/B4: 8.65945 | Sterimol/L: 15.8301 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 615.733 | Positive charged surface: 300.721 | Negative charged surface: 268.078 | Volume: 375.5 | |||
| Hydrophobic surface: 411.65 | Hydrophilic surface: 204.083 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
