 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | SCC(NC(=O)CCC([NH3+])C(=O)[O-])C(=O)NCC(=O)[O-] |
| InChI: | InChI=1/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/p-1/t5-,6+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=33.63 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 306.319 g/mol | logS: -1.18738 | SlogP: -5.5923 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0596375 | Sterimol/B1: 3.55661 | Sterimol/B2: 3.86638 | Sterimol/B3: 3.95108 | |||
| Sterimol/B4: 5.45118 | Sterimol/L: 17.6943 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 539.652 | Positive charged surface: 300.229 | Negative charged surface: 239.423 | Volume: 257.375 | |||
| Hydrophobic surface: 168.345 | Hydrophilic surface: 371.307 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
