 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | ClC(C(NC(=O)C1[NH+](CC(C1)CCC)C)C1OC(SC)C(O)C(O)C1O)C |
| InChI: | InChI=1/C18H33ClN2O5S/c1-5-6-10-7-11(21(3)8-10)17(25)20-12(9(2)19)16-14(23)13(22)15(24)18(26-16)27-4/h9-16,18,22-24H,5-8H2,1-4H3,(H,20,25)/p+1/t9-,10-,11+,12-,13+,14-,15+,16-,18+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=88.6945 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 425.998 g/mol | logS: -3.07016 | SlogP: -0.6077 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0642694 | Sterimol/B1: 3.50436 | Sterimol/B2: 3.66552 | Sterimol/B3: 4.71792 | |||
| Sterimol/B4: 6.24756 | Sterimol/L: 18.4795 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 668.743 | Positive charged surface: 475.84 | Negative charged surface: 192.903 | Volume: 402.75 | |||
| Hydrophobic surface: 421.575 | Hydrophilic surface: 247.168 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 9 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
