 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(=O)C2NC(=O)C(N)c2ccc(O)cc2)C(C(=O)[O-])=C(C1)\C=C\C |
| InChI: | InChI=1/C18H19N3O5S/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26)/p-1/b3-2+/t12-,13+,17-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=92.0804 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 388.424 g/mol | logS: -4.07462 | SlogP: -0.5325 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.126818 | Sterimol/B1: 3.91419 | Sterimol/B2: 4.50782 | Sterimol/B3: 4.96154 | |||
| Sterimol/B4: 6.97572 | Sterimol/L: 15.3673 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 614.714 | Positive charged surface: 297.671 | Negative charged surface: 293.499 | Volume: 344.75 | |||
| Hydrophobic surface: 309.03 | Hydrophilic surface: 305.684 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
