 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(CSc3nnnn3C)=C(N2C1=O)C(=O) [O-] |
| InChI: | InChI=1/C16H17N9O5S3/c1-24-16(20-22-23-24)33-4-6-3-31-13-9(12(27)25(13)10(6)14(28)29)19-11(26)8(21-30-2)7-5-32-15(17)18-7/h5,9,13H,3-4H2,1-2H3,(H2,17,18)(H,19,26)(H,28,29)/p-1/b21-8-/t9-,13+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=65.7536 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 510.56 g/mol | logS: -4.77127 | SlogP: -1.8453 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0699348 | Sterimol/B1: 4.31272 | Sterimol/B2: 4.37475 | Sterimol/B3: 4.58555 | |||
| Sterimol/B4: 7.33441 | Sterimol/L: 19.0453 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 723.393 | Positive charged surface: 350.966 | Negative charged surface: 314.528 | Volume: 406.25 | |||
| Hydrophobic surface: 357.813 | Hydrophilic surface: 365.58 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
