 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(=O)[O-])=C(C1)CSc1nnn n1C |
| InChI: | InChI=1/C19H18N6O6S2/c1-24-19(21-22-23-24)33-8-11-7-32-17-12(16(28)25(17)13(11)18(29)30)20-15(27)14(31-9-26)10-5-3-2-4-6-10/h2-6,9,12,14,17H,7-8H2,1H3,(H,20,27)(H,29,30)/p-1/t12-,14-,17+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=85.744 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 489.513 g/mol | logS: -5.17165 | SlogP: -0.9249 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0951176 | Sterimol/B1: 2.32531 | Sterimol/B2: 4.96873 | Sterimol/B3: 6.01682 | |||
| Sterimol/B4: 6.89091 | Sterimol/L: 19.2955 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 714.438 | Positive charged surface: 308.63 | Negative charged surface: 345.155 | Volume: 405.75 | |||
| Hydrophobic surface: 360.967 | Hydrophilic surface: 353.471 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
