 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(=O)C2NC(=O)C(O)c2ccccc2)C(C(=O)[O-])=C(C1)CSc1nnnn1C |
| InChI: | InChI=1/C18H18N6O5S2/c1-23-18(20-21-22-23)31-8-10-7-30-16-11(15(27)24(16)12(10)17(28)29)19-14(26)13(25)9-5-3-2-4-6-9/h2-6,11,13,16,25H,7-8H2,1H3,(H,19,26)(H,28,29)/p-1/t11-,13-,16+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=83.8438 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 461.503 g/mol | logS: -4.66466 | SlogP: -1.1056 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0832471 | Sterimol/B1: 2.30808 | Sterimol/B2: 4.18163 | Sterimol/B3: 5.59212 | |||
| Sterimol/B4: 6.71287 | Sterimol/L: 18.7652 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 682.926 | Positive charged surface: 291.232 | Negative charged surface: 330.938 | Volume: 385.75 | |||
| Hydrophobic surface: 367.416 | Hydrophilic surface: 315.51 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
