 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(C(=O)[O-])C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCNC1=O)c1cc ccc1 |
| InChI: | InChI=1/C20H23N5O6S/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29)/p-1/t11-,12-,13+,16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=69.3899 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 460.491 g/mol | logS: -3.96376 | SlogP: -1.145 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0947341 | Sterimol/B1: 2.50621 | Sterimol/B2: 5.50428 | Sterimol/B3: 6.08372 | |||
| Sterimol/B4: 6.57007 | Sterimol/L: 17.9861 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 702.662 | Positive charged surface: 384.678 | Negative charged surface: 287.163 | Volume: 400.375 | |||
| Hydrophobic surface: 386.434 | Hydrophilic surface: 316.228 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
