Type: Neutral
Formula: C12H18N2O3
SMILES: |
O=C1NC(=O)NC(=O)C1(C(CCC)C)CC=C |
InChI: |
InChI=1/C12H18N2O3/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17)/t8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 238.287 g/mol | logS: -3.55197 | SlogP: 1.3511 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.199124 | Sterimol/B1: 3.71673 | Sterimol/B2: 4.4501 | Sterimol/B3: 4.70801 |
Sterimol/B4: 4.93395 | Sterimol/L: 13.2137 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 434.578 | Positive charged surface: 259.869 | Negative charged surface: 174.709 | Volume: 229.25 |
Hydrophobic surface: 208.094 | Hydrophilic surface: 226.484 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |