Type: Neutral
Formula: C7H11NO7P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)(O)Cc1cccnc1 |
InChI: |
InChI=1/C7H11NO7P2/c9-7(16(10,11)12,17(13,14)15)4-6-2-1-3-8-5-6/h1-3,5,9H,4H2,(H2,10,11,12)(H2,13,14,15) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 283.113 g/mol | logS: 1.26789 | SlogP: -2.51483 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.155379 | Sterimol/B1: 3.0718 | Sterimol/B2: 3.67923 | Sterimol/B3: 4.21399 |
Sterimol/B4: 4.39115 | Sterimol/L: 12.3948 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 408.612 | Positive charged surface: 243.868 | Negative charged surface: 164.744 | Volume: 208.625 |
Hydrophobic surface: 159.711 | Hydrophilic surface: 248.901 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |