 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC(O)CNC1CCCCC1C)c1ccccc1C(C)C |
| InChI: | InChI=1/C19H31NO2/c1-14(2)17-9-5-7-11-19(17)22-13-16(21)12-20-18-10-6-4-8-15(18)3/h5,7,9,11,14-16,18,20-21H,4,6,8,10,12-13H2,1-3H3/t15-,16-,18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=68.5206 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 305.462 g/mol | logS: -3.86348 | SlogP: 3.718 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0618045 | Sterimol/B1: 2.33715 | Sterimol/B2: 2.79704 | Sterimol/B3: 5.60349 | |||
| Sterimol/B4: 6.99523 | Sterimol/L: 17.3461 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 617.095 | Positive charged surface: 450.648 | Negative charged surface: 166.447 | Volume: 334.375 | |||
| Hydrophobic surface: 513.205 | Hydrophilic surface: 103.89 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
