 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N(C)c1ccc(OC)cc1)c1cc(ccc1)C(=O)NC1CCCCC1C |
| InChI: | InChI=1/C22H28N2O4S/c1-16-7-4-5-10-21(16)23-22(25)17-8-6-9-20(15-17)29(26,27)24(2)18-11-13-19(28-3)14-12-18/h6,8-9,11-16,21H,4-5,7,10H2,1-3H3,(H,23,25)/t16-,21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=78.2588 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 416.542 g/mol | logS: -4.99172 | SlogP: 3.8288 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0588501 | Sterimol/B1: 2.66635 | Sterimol/B2: 4.11246 | Sterimol/B3: 5.2451 | |||
| Sterimol/B4: 6.6905 | Sterimol/L: 20.9184 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 696.717 | Positive charged surface: 468.278 | Negative charged surface: 228.44 | Volume: 398.125 | |||
| Hydrophobic surface: 586.417 | Hydrophilic surface: 110.3 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.