 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N1CCN(CC1)CC(=O)NCCCc1ccccc1)c1ccc(cc1C)C |
| InChI: | InChI=1/C23H31N3O3S/c1-19-10-11-22(20(2)17-19)30(28,29)26-15-13-25(14-16-26)18-23(27)24-12-6-9-21-7-4-3-5-8-21/h3-5,7-8,10-11,17H,6,9,12-16,18H2,1-2H3,(H,24,27) |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=122.49 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 429.585 g/mol | logS: -4.18327 | SlogP: 2.35871 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0570239 | Sterimol/B1: 2.09996 | Sterimol/B2: 3.8961 | Sterimol/B3: 4.55236 | |||
| Sterimol/B4: 9.301 | Sterimol/L: 20.4511 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 732.08 | Positive charged surface: 478.287 | Negative charged surface: 253.792 | Volume: 416.625 | |||
| Hydrophobic surface: 634.846 | Hydrophilic surface: 97.234 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
