 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CN1CCN(CC1)C(C(=O)Nc1cc(ccc1C)C)c1ccccc1 |
| InChI: | InChI=1/C25H33N3O2/c1-19-10-11-20(2)23(17-19)26-25(29)24(21-7-4-3-5-8-21)28-14-12-27(13-15-28)18-22-9-6-16-30-22/h3-5,7-8,10-11,17,22,24H,6,9,12-16,18H2,1-2H3,(H,26,29)/t22-,24+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=158.333 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 407.558 g/mol | logS: -4.6289 | SlogP: 3.87534 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.132851 | Sterimol/B1: 2.00792 | Sterimol/B2: 2.6879 | Sterimol/B3: 7.70107 | |||
| Sterimol/B4: 9.94019 | Sterimol/L: 17.745 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 738.493 | Positive charged surface: 532.986 | Negative charged surface: 205.507 | Volume: 419.75 | |||
| Hydrophobic surface: 715.735 | Hydrophilic surface: 22.758 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
