Type: Neutral
Formula: C19H28N2O3S
SMILES: |
S(=O)(=O)(N(CC=C)CC(=O)NC1CCCCC1C)c1ccc(cc1)C |
InChI: |
InChI=1/C19H28N2O3S/c1-4-13-21(25(23,24)17-11-9-15(2)10-12-17)14-19(22)20-18-8-6-5-7-16(18)3/h4,9-12,16,18H,1,5-8,13-14H2,2-3H3,(H,20,22)/t16-,18+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 364.51 g/mol | logS: -4.11407 | SlogP: 2.86662 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.150285 | Sterimol/B1: 2.08197 | Sterimol/B2: 3.03274 | Sterimol/B3: 5.6793 |
Sterimol/B4: 11.9767 | Sterimol/L: 13.4252 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 615.336 | Positive charged surface: 391.674 | Negative charged surface: 223.662 | Volume: 360.75 |
Hydrophobic surface: 475.564 | Hydrophilic surface: 139.772 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |