 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1c2c(nc1C1CCN(CC1)CC(=O)NC1CCCc3c1cccc3)cccc2 |
| InChI: | InChI=1/C24H27N3OS/c28-23(25-20-10-5-7-17-6-1-2-8-19(17)20)16-27-14-12-18(13-15-27)24-26-21-9-3-4-11-22(21)29-24/h1-4,6,8-9,11,18,20H,5,7,10,12-16H2,(H,25,28)/t20-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=89.1374 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.566 g/mol | logS: -5.103 | SlogP: 4.76497 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0493755 | Sterimol/B1: 2.46144 | Sterimol/B2: 3.62573 | Sterimol/B3: 4.79935 | |||
| Sterimol/B4: 7.19891 | Sterimol/L: 20.7351 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 696.322 | Positive charged surface: 461.38 | Negative charged surface: 234.941 | Volume: 395.875 | |||
| Hydrophobic surface: 645.977 | Hydrophilic surface: 50.345 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
