 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(NC(Cc1ccccc1)C(O)=O)c1cc(NC(=O)C)ccc1OCC |
| InChI: | InChI=1/C19H22N2O6S/c1-3-27-17-10-9-15(20-13(2)22)12-18(17)28(25,26)21-16(19(23)24)11-14-7-5-4-6-8-14/h4-10,12,16,21H,3,11H2,1-2H3,(H,20,22)(H,23,24)/t16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=72.7511 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.459 g/mol | logS: -3.63511 | SlogP: 2.01787 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0847419 | Sterimol/B1: 2.57397 | Sterimol/B2: 2.90119 | Sterimol/B3: 4.79384 | |||
| Sterimol/B4: 8.51847 | Sterimol/L: 17.5071 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 611.409 | Positive charged surface: 354.361 | Negative charged surface: 257.048 | Volume: 359 | |||
| Hydrophobic surface: 421.472 | Hydrophilic surface: 189.937 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
