Type: Neutral
Formula: C13H18N2OS
SMILES: |
S=C1NC=CC=C1C(=O)NC1CCCCC1C |
InChI: |
InChI=1/C13H18N2OS/c1-9-5-2-3-7-11(9)15-12(16)10-6-4-8-14-13(10)17/h4,6,8-9,11H,2-3,5,7H2,1H3,(H,14,17)(H,15,16)/t9-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 250.366 g/mol | logS: -3.78037 | SlogP: 2.052 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0882729 | Sterimol/B1: 2.39214 | Sterimol/B2: 3.14371 | Sterimol/B3: 4.24357 |
Sterimol/B4: 6.82054 | Sterimol/L: 14.3065 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 467.013 | Positive charged surface: 288.239 | Negative charged surface: 178.774 | Volume: 244.75 |
Hydrophobic surface: 330.299 | Hydrophilic surface: 136.714 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |