Type: Neutral
Formula: C17H23N5O3S2
SMILES: |
S(=O)(=O)(N1CCOCC1)c1ccc(NC(=S)NCCCn2ccnc2)cc1 |
InChI: |
InChI=1/C17H23N5O3S2/c23-27(24,22-10-12-25-13-11-22)16-4-2-15(3-5-16)20-17(26)19-6-1-8-21-9-7-18-14-21/h2-5,7,9,14H,1,6,8,10-13H2,(H2,19,20,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 409.535 g/mol | logS: -3.34421 | SlogP: 1.5471 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.029896 | Sterimol/B1: 3.64366 | Sterimol/B2: 3.98943 | Sterimol/B3: 4.00939 |
Sterimol/B4: 4.71861 | Sterimol/L: 21.5863 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 675.537 | Positive charged surface: 473.76 | Negative charged surface: 201.777 | Volume: 366.375 |
Hydrophobic surface: 480.345 | Hydrophilic surface: 195.192 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |