Type: Neutral
Formula: C15H14N6OS
SMILES: |
s1c2CCCCc2nc1NC(=O)c1ccccc1-n1nnnc1 |
InChI: |
InChI=1/C15H14N6OS/c22-14(18-15-17-11-6-2-4-8-13(11)23-15)10-5-1-3-7-12(10)21-9-16-19-20-21/h1,3,5,7,9H,2,4,6,8H2,(H,17,18,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 326.384 g/mol | logS: -3.42297 | SlogP: 2.24984 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0335052 | Sterimol/B1: 2.51177 | Sterimol/B2: 3.11614 | Sterimol/B3: 3.88379 |
Sterimol/B4: 7.90046 | Sterimol/L: 15.9742 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 537.976 | Positive charged surface: 322.285 | Negative charged surface: 183.378 | Volume: 286.625 |
Hydrophobic surface: 445.396 | Hydrophilic surface: 92.58 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |