Type: Neutral
Formula: C19H24N2O5S
SMILES: |
S(=O)(=O)(NNC(=O)CCCOc1cc(ccc1)C)c1ccc(OCC)cc1 |
InChI: |
InChI=1/C19H24N2O5S/c1-3-25-16-9-11-18(12-10-16)27(23,24)21-20-19(22)8-5-13-26-17-7-4-6-15(2)14-17/h4,6-7,9-12,14,21H,3,5,8,13H2,1-2H3,(H,20,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 392.476 g/mol | logS: -4.56991 | SlogP: 2.56242 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0169455 | Sterimol/B1: 2.41821 | Sterimol/B2: 2.76969 | Sterimol/B3: 4.03628 |
Sterimol/B4: 9.89429 | Sterimol/L: 21.5835 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 703.031 | Positive charged surface: 429.32 | Negative charged surface: 273.711 | Volume: 363.375 |
Hydrophobic surface: 537.94 | Hydrophilic surface: 165.091 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |