Type: Neutral
Formula: C20H20FNO3
SMILES: |
Fc1ccc(cc1)C(OC(C(=O)NC1CCCc2c1cccc2)C)=O |
InChI: |
InChI=1/C20H20FNO3/c1-13(25-20(24)15-9-11-16(21)12-10-15)19(23)22-18-8-4-6-14-5-2-3-7-17(14)18/h2-3,5,7,9-13,18H,4,6,8H2,1H3,(H,22,23)/t13-,18-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 341.382 g/mol | logS: -5.23013 | SlogP: 3.66027 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0704284 | Sterimol/B1: 2.13356 | Sterimol/B2: 4.1806 | Sterimol/B3: 5.53323 |
Sterimol/B4: 5.97481 | Sterimol/L: 17.4191 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 598.409 | Positive charged surface: 346.278 | Negative charged surface: 252.13 | Volume: 324.875 |
Hydrophobic surface: 514.091 | Hydrophilic surface: 84.318 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |