 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1c(cccc1OC)\C=C\C(OCC(=O)NC1CCCC(C)C1C)=O |
| InChI: | InChI=1/C21H29NO5/c1-14-7-5-9-17(15(14)2)22-19(23)13-27-20(24)12-11-16-8-6-10-18(25-3)21(16)26-4/h6,8,10-12,14-15,17H,5,7,9,13H2,1-4H3,(H,22,23)/b12-11+/t14-,15+,17+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=99.0007 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 375.465 g/mol | logS: -4.73389 | SlogP: 3.2011 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0215026 | Sterimol/B1: 2.90596 | Sterimol/B2: 4.19459 | Sterimol/B3: 4.27986 | |||
| Sterimol/B4: 5.42229 | Sterimol/L: 22.7729 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 696.858 | Positive charged surface: 503.1 | Negative charged surface: 193.758 | Volume: 375.875 | |||
| Hydrophobic surface: 562.879 | Hydrophilic surface: 133.979 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.