Type: Neutral
Formula: C21H21NO5
SMILES: |
O(C(=O)c1ccc(cc1)C(OC)=O)CC(=O)NC1CCCc2c1cccc2 |
InChI: |
InChI=1/C21H21NO5/c1-26-20(24)15-9-11-16(12-10-15)21(25)27-13-19(23)22-18-8-4-6-14-5-2-3-7-17(14)18/h2-3,5,7,9-12,18H,4,6,8,13H2,1H3,(H,22,23)/t18-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 367.401 g/mol | logS: -4.98967 | SlogP: 2.91927 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.046088 | Sterimol/B1: 2.71913 | Sterimol/B2: 3.37986 | Sterimol/B3: 4.74745 |
Sterimol/B4: 6.27037 | Sterimol/L: 19.6813 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 655.121 | Positive charged surface: 429.119 | Negative charged surface: 226.002 | Volume: 347.375 |
Hydrophobic surface: 536.808 | Hydrophilic surface: 118.313 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |