Type: Neutral
Formula: C20H23N3O5
SMILES: |
o1nc(-c2ccccc2)c(C(OCC(=O)NC(=O)NC2CCCCC2)=O)c1C |
InChI: |
InChI=1/C20H23N3O5/c1-13-17(18(23-28-13)14-8-4-2-5-9-14)19(25)27-12-16(24)22-20(26)21-15-10-6-3-7-11-15/h2,4-5,8-9,15H,3,6-7,10-12H2,1H3,(H2,21,22,24,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 385.42 g/mol | logS: -4.99377 | SlogP: 2.96532 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0325635 | Sterimol/B1: 2.22577 | Sterimol/B2: 3.50693 | Sterimol/B3: 3.91313 |
Sterimol/B4: 10.3303 | Sterimol/L: 19.2759 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 676.66 | Positive charged surface: 416.436 | Negative charged surface: 260.224 | Volume: 359 |
Hydrophobic surface: 520.435 | Hydrophilic surface: 156.225 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |