Type: Neutral
Formula: C19H19NO5
SMILES: |
Oc1cc(O)ccc1C(OCC(=O)NC1CCCc2c1cccc2)=O |
InChI: |
InChI=1/C19H19NO5/c21-13-8-9-15(17(22)10-13)19(24)25-11-18(23)20-16-7-3-5-12-4-1-2-6-14(12)16/h1-2,4,6,8-10,16,21-22H,3,5,7,11H2,(H,20,23)/t16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 341.363 g/mol | logS: -3.88404 | SlogP: 2.54387 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0586006 | Sterimol/B1: 2.44869 | Sterimol/B2: 3.12781 | Sterimol/B3: 4.62389 |
Sterimol/B4: 7.24115 | Sterimol/L: 17.7083 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 601.298 | Positive charged surface: 381.358 | Negative charged surface: 219.94 | Volume: 317.375 |
Hydrophobic surface: 437.707 | Hydrophilic surface: 163.591 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |