Type: Neutral
Formula: C18H21N5O2S
SMILES: |
S(=O)(=O)(N1CCCCC1)c1ccc(nc1)NCc1[nH]c2c(n1)cccc2 |
InChI: |
InChI=1/C18H21N5O2S/c24-26(25,23-10-4-1-5-11-23)14-8-9-17(19-12-14)20-13-18-21-15-6-2-3-7-16(15)22-18/h2-3,6-9,12H,1,4-5,10-11,13H2,(H,19,20)(H,21,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 371.465 g/mol | logS: -2.92159 | SlogP: 3.011 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0462068 | Sterimol/B1: 3.02945 | Sterimol/B2: 3.4161 | Sterimol/B3: 3.98217 |
Sterimol/B4: 5.51038 | Sterimol/L: 20.3347 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 632.626 | Positive charged surface: 409.268 | Negative charged surface: 223.358 | Volume: 338.75 |
Hydrophobic surface: 481.456 | Hydrophilic surface: 151.17 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |