 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cccc1C(=O)N1CCCC1C(=O)NCC(N1CCOCC1)(C)C |
| InChI: | InChI=1/C18H27N3O3S/c1-18(2,20-8-10-24-11-9-20)13-19-16(22)14-5-3-7-21(14)17(23)15-6-4-12-25-15/h4,6,12,14H,3,5,7-11,13H2,1-2H3,(H,19,22)/t14-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=125.893 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 365.498 g/mol | logS: -2.80043 | SlogP: 1.5797 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0970907 | Sterimol/B1: 2.29741 | Sterimol/B2: 4.9213 | Sterimol/B3: 5.48138 | |||
| Sterimol/B4: 6.22328 | Sterimol/L: 16.9617 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 605.055 | Positive charged surface: 412.93 | Negative charged surface: 192.125 | Volume: 348.5 | |||
| Hydrophobic surface: 512.601 | Hydrophilic surface: 92.454 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
