 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N1CCC(CC1)C(=O)NC1CCCc2c1cccc2)c1cc(ccc1)C(F)(F)F |
| InChI: | InChI=1/C23H25F3N2O3S/c24-23(25,26)18-7-4-8-19(15-18)32(30,31)28-13-11-17(12-14-28)22(29)27-21-10-3-6-16-5-1-2-9-20(16)21/h1-2,4-5,7-9,15,17,21H,3,6,10-14H2,(H,27,29)/t21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=67.9136 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 466.524 g/mol | logS: -5.50518 | SlogP: 4.70687 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.114902 | Sterimol/B1: 2.51502 | Sterimol/B2: 3.7106 | Sterimol/B3: 4.97717 | |||
| Sterimol/B4: 8.61388 | Sterimol/L: 16.2787 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 669.167 | Positive charged surface: 358.697 | Negative charged surface: 310.47 | Volume: 405.375 | |||
| Hydrophobic surface: 480.885 | Hydrophilic surface: 188.282 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.