Type: Neutral
Formula: C19H25N3O2S2
SMILES: |
s1ccnc1NC(=O)C(NC(=O)c1ccc(cc1)C(C)(C)C)CCSC |
InChI: |
InChI=1/C19H25N3O2S2/c1-19(2,3)14-7-5-13(6-8-14)16(23)21-15(9-11-25-4)17(24)22-18-20-10-12-26-18/h5-8,10,12,15H,9,11H2,1-4H3,(H,21,23)(H,20,22,24)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 391.56 g/mol | logS: -6.21204 | SlogP: 3.9308 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.046245 | Sterimol/B1: 2.17696 | Sterimol/B2: 4.7181 | Sterimol/B3: 4.92176 |
Sterimol/B4: 9.21914 | Sterimol/L: 18.7286 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 680.298 | Positive charged surface: 403.584 | Negative charged surface: 276.714 | Volume: 371.375 |
Hydrophobic surface: 495.64 | Hydrophilic surface: 184.658 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |