Type: Neutral
Formula: C20H17N3OS2
| SMILES: |
s1c2c(CCCC2)c(-c2[nH]c3c(n2)cccc3)c1NC(=O)c1sccc1 |
| InChI: |
InChI=1/C20H17N3OS2/c24-19(16-10-5-11-25-16)23-20-17(12-6-1-4-9-15(12)26-20)18-21-13-7-2-3-8-14(13)22-18/h2-3,5,7-8,10-11H,1,4,6,9H2,(H,21,22)(H,23,24) |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 379.508 g/mol | logS: -7.32072 | SlogP: 5.48394 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0159386 | Sterimol/B1: 2.50904 | Sterimol/B2: 2.86218 | Sterimol/B3: 3.06782 |
| Sterimol/B4: 11.0544 | Sterimol/L: 15.5531 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 605.613 | Positive charged surface: 333.699 | Negative charged surface: 271.913 | Volume: 341.375 |
| Hydrophobic surface: 555.279 | Hydrophilic surface: 50.334 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 0 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |