Type: Neutral
Formula: C17H20N4O3
SMILES: |
O=C1N(CC(=O)NC(C)C)C(=O)NC1Cc1c2c([nH]c1)cccc2 |
InChI: |
InChI=1/C17H20N4O3/c1-10(2)19-15(22)9-21-16(23)14(20-17(21)24)7-11-8-18-13-6-4-3-5-12(11)13/h3-6,8,10,14,18H,7,9H2,1-2H3,(H,19,22)(H,20,24)/t14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 328.372 g/mol | logS: -2.98075 | SlogP: 1.15537 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0750226 | Sterimol/B1: 3.72561 | Sterimol/B2: 3.92785 | Sterimol/B3: 4.34259 |
Sterimol/B4: 5.92524 | Sterimol/L: 17.1576 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 581.236 | Positive charged surface: 365.326 | Negative charged surface: 212.192 | Volume: 310.5 |
Hydrophobic surface: 362.288 | Hydrophilic surface: 218.948 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |