Type: Neutral
Formula: C18H24N4O3S2
SMILES: |
s1c(nnc1SCC)NC(=O)C(NC(OCc1ccccc1)=O)C(CC)C |
InChI: |
InChI=1/C18H24N4O3S2/c1-4-12(3)14(15(23)20-16-21-22-18(27-16)26-5-2)19-17(24)25-11-13-9-7-6-8-10-13/h6-10,12,14H,4-5,11H2,1-3H3,(H,19,24)(H,20,21,23)/t12-,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 408.547 g/mol | logS: -6.73879 | SlogP: 4.1961 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0500746 | Sterimol/B1: 2.14987 | Sterimol/B2: 2.82704 | Sterimol/B3: 5.1559 |
Sterimol/B4: 9.64691 | Sterimol/L: 20.9497 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 705.65 | Positive charged surface: 414.02 | Negative charged surface: 291.631 | Volume: 376 |
Hydrophobic surface: 482.685 | Hydrophilic surface: 222.965 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |