 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(S(=O)(=O)NC(C(C)C)C(=O)NCCc2ccc(S(=O)(=O)N)cc2)cc1 |
| InChI: | InChI=1/C19H24ClN3O5S2/c1-13(2)18(23-30(27,28)17-9-5-15(20)6-10-17)19(24)22-12-11-14-3-7-16(8-4-14)29(21,25)26/h3-10,13,18,23H,11-12H2,1-2H3,(H,22,24)(H2,21,25,26)/t18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=30.9358 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 474.002 g/mol | logS: -4.91645 | SlogP: 1.64917 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0679698 | Sterimol/B1: 2.7936 | Sterimol/B2: 3.11564 | Sterimol/B3: 4.74393 | |||
| Sterimol/B4: 10.3691 | Sterimol/L: 18.1337 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 717.937 | Positive charged surface: 354.437 | Negative charged surface: 363.501 | Volume: 403.375 | |||
| Hydrophobic surface: 461.781 | Hydrophilic surface: 256.156 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
