 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N1CCN(CC1)C(=O)C)c1cc(ccc1)C(=O)NC1CCCc2c1cccc2 |
| InChI: | InChI=1/C23H27N3O4S/c1-17(27)25-12-14-26(15-13-25)31(29,30)20-9-4-8-19(16-20)23(28)24-22-11-5-7-18-6-2-3-10-21(18)22/h2-4,6,8-10,16,22H,5,7,11-15H2,1H3,(H,24,28)/t22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=88.5762 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 441.552 g/mol | logS: -4.33611 | SlogP: 2.44227 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0496339 | Sterimol/B1: 2.76326 | Sterimol/B2: 3.75177 | Sterimol/B3: 4.2327 | |||
| Sterimol/B4: 8.63834 | Sterimol/L: 18.1665 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 703.749 | Positive charged surface: 439.039 | Negative charged surface: 264.71 | Volume: 408.125 | |||
| Hydrophobic surface: 583.296 | Hydrophilic surface: 120.453 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.