Type: Neutral
Formula: C20H22BrNO4
SMILES: |
Brc1cc(CO)c(OCC(=O)NC2CCCc3c2cccc3)c(c1)CO |
InChI: |
InChI=1/C20H22BrNO4/c21-16-8-14(10-23)20(15(9-16)11-24)26-12-19(25)22-18-7-3-5-13-4-1-2-6-17(13)18/h1-2,4,6,8-9,18,23-24H,3,5,7,10-12H2,(H,22,25)/t18-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 420.303 g/mol | logS: -4.90902 | SlogP: 3.63457 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0367344 | Sterimol/B1: 2.75819 | Sterimol/B2: 2.9811 | Sterimol/B3: 3.745 |
Sterimol/B4: 8.30268 | Sterimol/L: 17.9019 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 644.306 | Positive charged surface: 374.887 | Negative charged surface: 269.42 | Volume: 358.5 |
Hydrophobic surface: 495.324 | Hydrophilic surface: 148.982 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |