 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)([O-])(=[NH])c1ccc(cc1)CNC(=O)C(CCC)c1ccccc1 |
| InChI: | InChI=1/C18H22N2O3S/c1-2-6-17(15-7-4-3-5-8-15)18(21)20-13-14-9-11-16(12-10-14)24(19,22)23/h3-5,7-12,17H,2,6,13H2,1H3,(H3,19,20,21,22,23)/p-1/t17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=43.7306 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 345.443 g/mol | logS: -4.84359 | SlogP: 3.1247 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0986261 | Sterimol/B1: 2.53159 | Sterimol/B2: 3.35621 | Sterimol/B3: 4.85413 | |||
| Sterimol/B4: 8.46831 | Sterimol/L: 17.4485 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 624.509 | Positive charged surface: 341.665 | Negative charged surface: 282.844 | Volume: 330.625 | |||
| Hydrophobic surface: 459.7 | Hydrophilic surface: 164.809 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
