Type: Neutral
Formula: C18H22N4O3
SMILES: |
O=C1N(CC(=O)NCC(C)C)C(=O)NC1Cc1c2c([nH]c1)cccc2 |
InChI: |
InChI=1/C18H22N4O3/c1-11(2)8-20-16(23)10-22-17(24)15(21-18(22)25)7-12-9-19-14-6-4-3-5-13(12)14/h3-6,9,11,15,19H,7-8,10H2,1-2H3,(H,20,23)(H,21,25)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 342.399 g/mol | logS: -3.05708 | SlogP: 1.40297 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0607696 | Sterimol/B1: 2.43547 | Sterimol/B2: 4.19616 | Sterimol/B3: 5.73505 |
Sterimol/B4: 5.83082 | Sterimol/L: 18.4548 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 609.213 | Positive charged surface: 389.371 | Negative charged surface: 216.069 | Volume: 328.25 |
Hydrophobic surface: 390.933 | Hydrophilic surface: 218.28 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |