 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C(C(=O)NC1CCCc2c1cccc2)C)c1ccc(cc1C)-c1ccc(cc1)C |
| InChI: | InChI=1/C27H29NO2/c1-18-11-13-21(14-12-18)23-15-16-26(19(2)17-23)30-20(3)27(29)28-25-10-6-8-22-7-4-5-9-24(22)25/h4-5,7,9,11-17,20,25H,6,8,10H2,1-3H3,(H,28,29)/t20-,25-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=123.819 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 399.534 g/mol | logS: -7.66457 | SlogP: 6.02701 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0400162 | Sterimol/B1: 3.4237 | Sterimol/B2: 3.50741 | Sterimol/B3: 4.13399 | |||
| Sterimol/B4: 6.0437 | Sterimol/L: 21.6498 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 720.421 | Positive charged surface: 431.331 | Negative charged surface: 279.116 | Volume: 411.75 | |||
| Hydrophobic surface: 669.379 | Hydrophilic surface: 51.042 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.