Type: Neutral
Formula: C18H23ClFNO3
SMILES: |
Clc1cccc(F)c1CC(OCC(=O)NC1CCCC(C)C1C)=O |
InChI: |
InChI=1/C18H23ClFNO3/c1-11-5-3-8-16(12(11)2)21-17(22)10-24-18(23)9-13-14(19)6-4-7-15(13)20/h4,6-7,11-12,16H,3,5,8-10H2,1-2H3,(H,21,22)/t11-,12-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 355.837 g/mol | logS: -5.21805 | SlogP: 3.50567 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0419407 | Sterimol/B1: 2.32703 | Sterimol/B2: 3.49902 | Sterimol/B3: 4.60042 |
Sterimol/B4: 5.26748 | Sterimol/L: 18.7143 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 609.47 | Positive charged surface: 362.174 | Negative charged surface: 247.296 | Volume: 327.25 |
Hydrophobic surface: 503.383 | Hydrophilic surface: 106.087 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |