Type: Neutral
Formula: C21H24N2O4S
SMILES: |
s1cccc1C(=O)N1CCCC1C(OCC(=O)Nc1ccc(cc1)C(C)C)=O |
InChI: |
InChI=1/C21H24N2O4S/c1-14(2)15-7-9-16(10-8-15)22-19(24)13-27-21(26)17-5-3-11-23(17)20(25)18-6-4-12-28-18/h4,6-10,12,14,17H,3,5,11,13H2,1-2H3,(H,22,24)/t17-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 400.499 g/mol | logS: -5.69303 | SlogP: 3.658 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0311908 | Sterimol/B1: 3.39564 | Sterimol/B2: 3.78805 | Sterimol/B3: 4.42115 |
Sterimol/B4: 6.48814 | Sterimol/L: 22.1673 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 695.865 | Positive charged surface: 426.627 | Negative charged surface: 269.239 | Volume: 375.875 |
Hydrophobic surface: 551.6 | Hydrophilic surface: 144.265 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |